C10H14ClNO — CID 70441913
1-(3-chloro-N,4-dimethylanilino)ethanol (PubChem CID 70441913) has the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. Its IUPAC name is 1-(3-chloro-N,4-dimethylanilino)ethanol.
| Compound Name | 1-(3-chloro-N,4-dimethylanilino)ethanol |
|---|---|
| PubChem CID | 70441913 |
| Molecular Formula | C10H14ClNO |
| Molecular Weight | 199.68 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 1-(3-chloro-N,4-dimethylanilino)ethanol |
| SMILES | Cc1ccc(N(C)C(C)O)cc1Cl |
| InChI | InChI=1S/C10H14ClNO/c1-7-4-5-9(6-10(7)11)12(3)8(2)13/h4-6,8,13H,1-3H3 |
| InChIKey | XTSBBQDFMXLBBW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.68 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|