C23H21N5O2S2 — CID 133155454
ethyl 2-[5-[1-(1,3-benzothiazol-2-yl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]acetate (PubChem CID 133155454) has the molecular formula C23H21N5O2S2 and a molecular weight of 463.59 g/mol. Its IUPAC name is ethyl 2-[5-[1-(1,3-benzothiazol-2-yl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]acetate.
| Compound Name | ethyl 2-[5-[1-(1,3-benzothiazol-2-yl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 133155454 |
| Molecular Formula | C23H21N5O2S2 |
| Molecular Weight | 463.59 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | ethyl 2-[5-[1-(1,3-benzothiazol-2-yl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]acetate |
| SMILES | CCOC(=O)CN1C(=S)NC(c2ccccn2)C1c1cccn1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C23H21N5O2S2/c1-2-30-19(29)14-28-21(20(26-22(28)31)16-9-5-6-12-24-16)17-10-7-13-27(17)23-25-15-8-3-4-11-18(15)32-23/h3-13,20-21H,2,14H2,1H3,(H,26,31) |
| InChIKey | FVMVQZVWFHCVCM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.59 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|