C24H25N7S — CID 133158559
5-[2,5-dimethyl-1-(1,2,4-triazol-4-yl)pyrrol-3-yl]-1-(4-ethylphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133158559) has the molecular formula C24H25N7S and a molecular weight of 443.58 g/mol. Its IUPAC name is 5-[2,5-dimethyl-1-(1,2,4-triazol-4-yl)pyrrol-3-yl]-1-(4-ethylphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[2,5-dimethyl-1-(1,2,4-triazol-4-yl)pyrrol-3-yl]-1-(4-ethylphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133158559 |
| Molecular Formula | C24H25N7S |
| Molecular Weight | 443.58 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 5-[2,5-dimethyl-1-(1,2,4-triazol-4-yl)pyrrol-3-yl]-1-(4-ethylphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CCc1ccc(N2C(=S)NC(c3ccccn3)C2c2cc(C)n(-n3cnnc3)c2C)cc1 |
| InChI | InChI=1S/C24H25N7S/c1-4-18-8-10-19(11-9-18)30-23(22(28-24(30)32)21-7-5-6-12-25-21)20-13-16(2)31(17(20)3)29-14-26-27-15-29/h5-15,22-23H,4H2,1-3H3,(H,28,32) |
| InChIKey | GFNHOSDYHKXAOH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 63.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.58 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|