C21H24ClNO3 — CID 133164804
N-[2-(4-chlorophenoxy)ethyl]-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propanamide (PubChem CID 133164804) has the molecular formula C21H24ClNO3 and a molecular weight of 373.88 g/mol. Its IUPAC name is N-[2-(4-chlorophenoxy)ethyl]-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propanamide.
| Compound Name | N-[2-(4-chlorophenoxy)ethyl]-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propanamide |
|---|---|
| PubChem CID | 133164804 |
| Molecular Formula | C21H24ClNO3 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | N-[2-(4-chlorophenoxy)ethyl]-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propanamide |
| SMILES | CC(Oc1cccc2c1CCCC2)C(=O)NCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H24ClNO3/c1-15(26-20-8-4-6-16-5-2-3-7-19(16)20)21(24)23-13-14-25-18-11-9-17(22)10-12-18/h4,6,8-12,15H,2-3,5,7,13-14H2,1H3,(H,23,24) |
| InChIKey | MHNZAUYXEAOKFB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|