C22H25Cl2NO2S — CID 133265315
N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propanamide (PubChem CID 133265315) has the molecular formula C22H25Cl2NO2S and a molecular weight of 438.42 g/mol. Its IUPAC name is N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propanamide.
| Compound Name | N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propanamide |
|---|---|
| PubChem CID | 133265315 |
| Molecular Formula | C22H25Cl2NO2S |
| Molecular Weight | 438.42 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propanamide |
| SMILES | CC(Oc1cccc2c1CCCC2)C(=O)NCCSCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H25Cl2NO2S/c1-15(27-21-8-4-6-16-5-2-3-7-19(16)21)22(26)25-11-12-28-14-17-9-10-18(23)13-20(17)24/h4,6,8-10,13,15H,2-3,5,7,11-12,14H2,1H3,(H,25,26) |
| InChIKey | SSGBXIXEQNFZNZ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.42 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|