C17H28N2O3S2 — CID 133164856
N-[5-(2-ethylhexylsulfamoyl)-2-methylsulfanylphenyl]acetamide (PubChem CID 133164856) has the molecular formula C17H28N2O3S2 and a molecular weight of 372.56 g/mol. Its IUPAC name is N-[5-(2-ethylhexylsulfamoyl)-2-methylsulfanylphenyl]acetamide.
| Compound Name | N-[5-(2-ethylhexylsulfamoyl)-2-methylsulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 133164856 |
| Molecular Formula | C17H28N2O3S2 |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | N-[5-(2-ethylhexylsulfamoyl)-2-methylsulfanylphenyl]acetamide |
| SMILES | CCCCC(CC)CNS(=O)(=O)c1ccc(SC)c(NC(C)=O)c1 |
| InChI | InChI=1S/C17H28N2O3S2/c1-5-7-8-14(6-2)12-18-24(21,22)15-9-10-17(23-4)16(11-15)19-13(3)20/h9-11,14,18H,5-8,12H2,1-4H3,(H,19,20) |
| InChIKey | SBUUIVLMVLOLGX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |