C25H23N5OS — CID 133183177
5-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-1-(2-hydroxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133183177) has the molecular formula C25H23N5OS and a molecular weight of 441.56 g/mol. Its IUPAC name is 5-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-1-(2-hydroxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-1-(2-hydroxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133183177 |
| Molecular Formula | C25H23N5OS |
| Molecular Weight | 441.56 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 5-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-1-(2-hydroxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc(C2C(c3ccccn3)NC(=S)N2c2ccccc2O)c(C)n1-c1ccccn1 |
| InChI | InChI=1S/C25H23N5OS/c1-16-15-18(17(2)29(16)22-12-6-8-14-27-22)24-23(19-9-5-7-13-26-19)28-25(32)30(24)20-10-3-4-11-21(20)31/h3-15,23-24,31H,1-2H3,(H,28,32) |
| InChIKey | LCGPOQFBGQNKIT-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.56 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|