C12H12N6O2 — CID 133185641
2-(3-methyl-2-pyridinyl)-1-(5-nitro-2-pyridinyl)guanidine (PubChem CID 133185641) has the molecular formula C12H12N6O2 and a molecular weight of 272.27 g/mol. Its IUPAC name is 2-(3-methyl-2-pyridinyl)-1-(5-nitro-2-pyridinyl)guanidine.
| Compound Name | 2-(3-methyl-2-pyridinyl)-1-(5-nitro-2-pyridinyl)guanidine |
|---|---|
| PubChem CID | 133185641 |
| Molecular Formula | C12H12N6O2 |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 2-(3-methyl-2-pyridinyl)-1-(5-nitro-2-pyridinyl)guanidine |
| SMILES | Cc1cccnc1/N=C(\N)Nc1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C12H12N6O2/c1-8-3-2-6-14-11(8)17-12(13)16-10-5-4-9(7-15-10)18(19)20/h2-7H,1H3,(H3,13,14,15,16,17) |
| InChIKey | RNVZPJIMDKRHLS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|