C25H24N2O3S — CID 133186865
N-[(Z)-3-[(2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide (PubChem CID 133186865) has the molecular formula C25H24N2O3S and a molecular weight of 432.55 g/mol. Its IUPAC name is N-[(Z)-3-[(2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[(2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 133186865 |
| Molecular Formula | C25H24N2O3S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | N-[(Z)-3-[(2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
| SMILES | CC1(C)CC(NC(=O)/C(=C/c2cccs2)NC(=O)c2ccccc2)c2ccccc2O1 |
| InChI | InChI=1S/C25H24N2O3S/c1-25(2)16-21(19-12-6-7-13-22(19)30-25)27-24(29)20(15-18-11-8-14-31-18)26-23(28)17-9-4-3-5-10-17/h3-15,21H,16H2,1-2H3,(H,26,28)(H,27,29)/b20-15- |
| InChIKey | AYYANCYTOUIBRN-HKWRFOASSA-N |
| XLogP | 4.94 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|