C24H34N2O4S — CID 133202217
4-(4-methoxy-N-methylsulfonylanilino)-N-(4-methyl-4-phenylpentan-2-yl)butanamide (PubChem CID 133202217) has the molecular formula C24H34N2O4S and a molecular weight of 446.61 g/mol. Its IUPAC name is 4-(4-methoxy-N-methylsulfonylanilino)-N-(4-methyl-4-phenylpentan-2-yl)butanamide.
| Compound Name | 4-(4-methoxy-N-methylsulfonylanilino)-N-(4-methyl-4-phenylpentan-2-yl)butanamide |
|---|---|
| PubChem CID | 133202217 |
| Molecular Formula | C24H34N2O4S |
| Molecular Weight | 446.61 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 4-(4-methoxy-N-methylsulfonylanilino)-N-(4-methyl-4-phenylpentan-2-yl)butanamide |
| SMILES | COc1ccc(N(CCCC(=O)NC(C)CC(C)(C)c2ccccc2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C24H34N2O4S/c1-19(18-24(2,3)20-10-7-6-8-11-20)25-23(27)12-9-17-26(31(5,28)29)21-13-15-22(30-4)16-14-21/h6-8,10-11,13-16,19H,9,12,17-18H2,1-5H3,(H,25,27) |
| InChIKey | ILWJJJDYEYBTOU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.61 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |