C23H31N3O5S — CID 133262283
N-butan-2-yl-2-[4-(4-methoxy-N-methylsulfonylanilino)butanoylamino]benzamide (PubChem CID 133262283) has the molecular formula C23H31N3O5S and a molecular weight of 461.58 g/mol. Its IUPAC name is N-butan-2-yl-2-[4-(4-methoxy-N-methylsulfonylanilino)butanoylamino]benzamide.
| Compound Name | N-butan-2-yl-2-[4-(4-methoxy-N-methylsulfonylanilino)butanoylamino]benzamide |
|---|---|
| PubChem CID | 133262283 |
| Molecular Formula | C23H31N3O5S |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | N-butan-2-yl-2-[4-(4-methoxy-N-methylsulfonylanilino)butanoylamino]benzamide |
| SMILES | CCC(C)NC(=O)c1ccccc1NC(=O)CCCN(c1ccc(OC)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C23H31N3O5S/c1-5-17(2)24-23(28)20-9-6-7-10-21(20)25-22(27)11-8-16-26(32(4,29)30)18-12-14-19(31-3)15-13-18/h6-7,9-10,12-15,17H,5,8,11,16H2,1-4H3,(H,24,28)(H,25,27) |
| InChIKey | XZWLEGDIZTUMRM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |