C20H17ClN4O3S — CID 133203261
3-(4-chlorophenyl)-3-[(6-phenoxypyridazin-3-yl)carbamothioylamino]propanoic acid (PubChem CID 133203261) has the molecular formula C20H17ClN4O3S and a molecular weight of 428.90 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-3-[(6-phenoxypyridazin-3-yl)carbamothioylamino]propanoic acid.
| Compound Name | 3-(4-chlorophenyl)-3-[(6-phenoxypyridazin-3-yl)carbamothioylamino]propanoic acid |
|---|---|
| PubChem CID | 133203261 |
| Molecular Formula | C20H17ClN4O3S |
| Molecular Weight | 428.90 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | 3-(4-chlorophenyl)-3-[(6-phenoxypyridazin-3-yl)carbamothioylamino]propanoic acid |
| SMILES | O=C(O)CC(NC(=S)Nc1ccc(Oc2ccccc2)nn1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H17ClN4O3S/c21-14-8-6-13(7-9-14)16(12-19(26)27)22-20(29)23-17-10-11-18(25-24-17)28-15-4-2-1-3-5-15/h1-11,16H,12H2,(H,26,27)(H2,22,23,24,29) |
| InChIKey | FYCWEIOGWTYMHY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.90 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|