C20H33N3O5S — CID 133213477
2-[(4-methoxyphenyl)methyl-[2-[methyl(methylsulfonyl)amino]acetyl]amino]-N-pentylpropanamide (PubChem CID 133213477) has the molecular formula C20H33N3O5S and a molecular weight of 427.57 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methyl-[2-[methyl(methylsulfonyl)amino]acetyl]amino]-N-pentylpropanamide.
| Compound Name | 2-[(4-methoxyphenyl)methyl-[2-[methyl(methylsulfonyl)amino]acetyl]amino]-N-pentylpropanamide |
|---|---|
| PubChem CID | 133213477 |
| Molecular Formula | C20H33N3O5S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 2-[(4-methoxyphenyl)methyl-[2-[methyl(methylsulfonyl)amino]acetyl]amino]-N-pentylpropanamide |
| SMILES | CCCCCNC(=O)C(C)N(Cc1ccc(OC)cc1)C(=O)CN(C)S(C)(=O)=O |
| InChI | InChI=1S/C20H33N3O5S/c1-6-7-8-13-21-20(25)16(2)23(19(24)15-22(3)29(5,26)27)14-17-9-11-18(28-4)12-10-17/h9-12,16H,6-8,13-15H2,1-5H3,(H,21,25) |
| InChIKey | QOARKYUWQSACFU-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|