C29H33N3O4S — CID 133213744
2-[benzyl-[2-[benzyl(methylsulfonyl)amino]acetyl]amino]-3-phenyl-N-prop-2-enylpropanamide (PubChem CID 133213744) has the molecular formula C29H33N3O4S and a molecular weight of 519.67 g/mol. Its IUPAC name is 2-[benzyl-[2-[benzyl(methylsulfonyl)amino]acetyl]amino]-3-phenyl-N-prop-2-enylpropanamide.
| Compound Name | 2-[benzyl-[2-[benzyl(methylsulfonyl)amino]acetyl]amino]-3-phenyl-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 133213744 |
| Molecular Formula | C29H33N3O4S |
| Molecular Weight | 519.67 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | 2-[benzyl-[2-[benzyl(methylsulfonyl)amino]acetyl]amino]-3-phenyl-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)C(Cc1ccccc1)N(Cc1ccccc1)C(=O)CN(Cc1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C29H33N3O4S/c1-3-19-30-29(34)27(20-24-13-7-4-8-14-24)32(22-26-17-11-6-12-18-26)28(33)23-31(37(2,35)36)21-25-15-9-5-10-16-25/h3-18,27H,1,19-23H2,2H3,(H,30,34) |
| InChIKey | BXVZFBGSEVEUOO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.67 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|