C21H23N5S — CID 133222037
1-(2-methylpropyl)-4-pyridin-2-yl-5-(1-pyridin-4-ylpyrrol-2-yl)imidazolidine-2-thione (PubChem CID 133222037) has the molecular formula C21H23N5S and a molecular weight of 377.52 g/mol. Its IUPAC name is 1-(2-methylpropyl)-4-pyridin-2-yl-5-(1-pyridin-4-ylpyrrol-2-yl)imidazolidine-2-thione.
| Compound Name | 1-(2-methylpropyl)-4-pyridin-2-yl-5-(1-pyridin-4-ylpyrrol-2-yl)imidazolidine-2-thione |
|---|---|
| PubChem CID | 133222037 |
| Molecular Formula | C21H23N5S |
| Molecular Weight | 377.52 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 1-(2-methylpropyl)-4-pyridin-2-yl-5-(1-pyridin-4-ylpyrrol-2-yl)imidazolidine-2-thione |
| SMILES | CC(C)CN1C(=S)NC(c2ccccn2)C1c1cccn1-c1ccncc1 |
| InChI | InChI=1S/C21H23N5S/c1-15(2)14-26-20(19(24-21(26)27)17-6-3-4-10-23-17)18-7-5-13-25(18)16-8-11-22-12-9-16/h3-13,15,19-20H,14H2,1-2H3,(H,24,27) |
| InChIKey | WONLZGWCKMMDFA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|