C26H32N4S — CID 133222098
5-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-1-(2-methylpropyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133222098) has the molecular formula C26H32N4S and a molecular weight of 432.64 g/mol. Its IUPAC name is 5-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-1-(2-methylpropyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-1-(2-methylpropyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133222098 |
| Molecular Formula | C26H32N4S |
| Molecular Weight | 432.64 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 5-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-1-(2-methylpropyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc(C)cc(-n2c(C)cc(C3C(c4ccccn4)NC(=S)N3CC(C)C)c2C)c1 |
| InChI | InChI=1S/C26H32N4S/c1-16(2)15-29-25(24(28-26(29)31)23-9-7-8-10-27-23)22-14-19(5)30(20(22)6)21-12-17(3)11-18(4)13-21/h7-14,16,24-25H,15H2,1-6H3,(H,28,31) |
| InChIKey | ZSZJRTLNRFRRNO-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.64 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|