C28H28N4O2S — CID 133223892
1-(2,5-dimethoxyphenyl)-5-[1-(3,4-dimethylphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133223892) has the molecular formula C28H28N4O2S and a molecular weight of 484.63 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-5-[1-(3,4-dimethylphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(2,5-dimethoxyphenyl)-5-[1-(3,4-dimethylphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133223892 |
| Molecular Formula | C28H28N4O2S |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-5-[1-(3,4-dimethylphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1ccc(OC)c(N2C(=S)NC(c3ccccn3)C2c2cccn2-c2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C28H28N4O2S/c1-18-10-11-20(16-19(18)2)31-15-7-9-23(31)27-26(22-8-5-6-14-29-22)30-28(35)32(27)24-17-21(33-3)12-13-25(24)34-4/h5-17,26-27H,1-4H3,(H,30,35) |
| InChIKey | NJHOYZBTFKYVQF-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|