C15H22N2O4S — CID 133230277
N-(4-ethoxyphenyl)-2,6-dimethyl-1,1-dioxothiazinane-6-carboxamide (PubChem CID 133230277) has the molecular formula C15H22N2O4S and a molecular weight of 326.42 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2,6-dimethyl-1,1-dioxothiazinane-6-carboxamide.
| Compound Name | N-(4-ethoxyphenyl)-2,6-dimethyl-1,1-dioxothiazinane-6-carboxamide |
|---|---|
| PubChem CID | 133230277 |
| Molecular Formula | C15H22N2O4S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | N-(4-ethoxyphenyl)-2,6-dimethyl-1,1-dioxothiazinane-6-carboxamide |
| SMILES | CCOc1ccc(NC(=O)C2(C)CCCN(C)S2(=O)=O)cc1 |
| InChI | InChI=1S/C15H22N2O4S/c1-4-21-13-8-6-12(7-9-13)16-14(18)15(2)10-5-11-17(3)22(15,19)20/h6-9H,4-5,10-11H2,1-3H3,(H,16,18) |
| InChIKey | HAHFDHWRVKBYTF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |