C28H31FN2O3 — CID 133238351
2-[(4-fluorophenyl)methyl-(2-phenoxyacetyl)amino]-N-(3-methylbutyl)-2-phenylacetamide (PubChem CID 133238351) has the molecular formula C28H31FN2O3 and a molecular weight of 462.57 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl-(2-phenoxyacetyl)amino]-N-(3-methylbutyl)-2-phenylacetamide.
| Compound Name | 2-[(4-fluorophenyl)methyl-(2-phenoxyacetyl)amino]-N-(3-methylbutyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 133238351 |
| Molecular Formula | C28H31FN2O3 |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl-(2-phenoxyacetyl)amino]-N-(3-methylbutyl)-2-phenylacetamide |
| SMILES | CC(C)CCNC(=O)C(c1ccccc1)N(Cc1ccc(F)cc1)C(=O)COc1ccccc1 |
| InChI | InChI=1S/C28H31FN2O3/c1-21(2)17-18-30-28(33)27(23-9-5-3-6-10-23)31(19-22-13-15-24(29)16-14-22)26(32)20-34-25-11-7-4-8-12-25/h3-16,21,27H,17-20H2,1-2H3,(H,30,33) |
| InChIKey | FKHLYKBVOLYDTE-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |