C18H20FN3O3 — CID 133239194
N-[5-(3-fluorophenyl)pyrazolidin-3-yl]-3,4-dimethoxybenzamide (PubChem CID 133239194) has the molecular formula C18H20FN3O3 and a molecular weight of 345.37 g/mol. Its IUPAC name is N-[5-(3-fluorophenyl)pyrazolidin-3-yl]-3,4-dimethoxybenzamide.
| Compound Name | N-[5-(3-fluorophenyl)pyrazolidin-3-yl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 133239194 |
| Molecular Formula | C18H20FN3O3 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | N-[5-(3-fluorophenyl)pyrazolidin-3-yl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NC2CC(c3cccc(F)c3)NN2)cc1OC |
| InChI | InChI=1S/C18H20FN3O3/c1-24-15-7-6-12(9-16(15)25-2)18(23)20-17-10-14(21-22-17)11-4-3-5-13(19)8-11/h3-9,14,17,21-22H,10H2,1-2H3,(H,20,23) |
| InChIKey | KYVQRQWDAMELCA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |