C23H39NO3 — CID 133246333
N-(4-butan-2-yloxy-3,5-dimethylphenyl)-2-methyl-2-propoxyheptanamide (PubChem CID 133246333) has the molecular formula C23H39NO3 and a molecular weight of 377.57 g/mol. Its IUPAC name is N-(4-butan-2-yloxy-3,5-dimethylphenyl)-2-methyl-2-propoxyheptanamide.
| Compound Name | N-(4-butan-2-yloxy-3,5-dimethylphenyl)-2-methyl-2-propoxyheptanamide |
|---|---|
| PubChem CID | 133246333 |
| Molecular Formula | C23H39NO3 |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.29 |
| IUPAC Name | N-(4-butan-2-yloxy-3,5-dimethylphenyl)-2-methyl-2-propoxyheptanamide |
| SMILES | CCCCCC(C)(OCCC)C(=O)Nc1cc(C)c(OC(C)CC)c(C)c1 |
| InChI | InChI=1S/C23H39NO3/c1-8-11-12-13-23(7,26-14-9-2)22(25)24-20-15-17(4)21(18(5)16-20)27-19(6)10-3/h15-16,19H,8-14H2,1-7H3,(H,24,25) |
| InChIKey | ARIYHKQPXDDSAB-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|