C24H33NO3 — CID 133252205
N-[2-(2-tert-butylphenoxy)ethyl]-2-(3,4-dimethylphenoxy)butanamide (PubChem CID 133252205) has the molecular formula C24H33NO3 and a molecular weight of 383.53 g/mol. Its IUPAC name is N-[2-(2-tert-butylphenoxy)ethyl]-2-(3,4-dimethylphenoxy)butanamide.
| Compound Name | N-[2-(2-tert-butylphenoxy)ethyl]-2-(3,4-dimethylphenoxy)butanamide |
|---|---|
| PubChem CID | 133252205 |
| Molecular Formula | C24H33NO3 |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | N-[2-(2-tert-butylphenoxy)ethyl]-2-(3,4-dimethylphenoxy)butanamide |
| SMILES | CCC(Oc1ccc(C)c(C)c1)C(=O)NCCOc1ccccc1C(C)(C)C |
| InChI | InChI=1S/C24H33NO3/c1-7-21(28-19-13-12-17(2)18(3)16-19)23(26)25-14-15-27-22-11-9-8-10-20(22)24(4,5)6/h8-13,16,21H,7,14-15H2,1-6H3,(H,25,26) |
| InChIKey | MJXSQKZQIWQYIX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|