C31H38N2O5S — CID 133252218
4-(benzenesulfonyl)-6-tert-butyl-N-[2-(2-tert-butylphenoxy)ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 133252218) has the molecular formula C31H38N2O5S and a molecular weight of 550.72 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-6-tert-butyl-N-[2-(2-tert-butylphenoxy)ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | 4-(benzenesulfonyl)-6-tert-butyl-N-[2-(2-tert-butylphenoxy)ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 133252218 |
| Molecular Formula | C31H38N2O5S |
| Molecular Weight | 550.72 g/mol |
| Exact Mass | 550.25 |
| IUPAC Name | 4-(benzenesulfonyl)-6-tert-butyl-N-[2-(2-tert-butylphenoxy)ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | CC(C)(C)c1ccc2c(c1)N(S(=O)(=O)c1ccccc1)CC(C(=O)NCCOc1ccccc1C(C)(C)C)O2 |
| InChI | InChI=1S/C31H38N2O5S/c1-30(2,3)22-16-17-27-25(20-22)33(39(35,36)23-12-8-7-9-13-23)21-28(38-27)29(34)32-18-19-37-26-15-11-10-14-24(26)31(4,5)6/h7-17,20,28H,18-19,21H2,1-6H3,(H,32,34) |
| InChIKey | FSGGVDIOYBJQEP-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.72 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|