C31H37N3O7S2 — CID 125070862
(2R)-4-(benzenesulfonyl)-6-tert-butyl-N-[2-(4-pyrrolidin-1-ylsulfonylphenoxy)ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 125070862) has the molecular formula C31H37N3O7S2 and a molecular weight of 627.79 g/mol. Its IUPAC name is (2R)-4-(benzenesulfonyl)-6-tert-butyl-N-[2-(4-pyrrolidin-1-ylsulfonylphenoxy)ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | (2R)-4-(benzenesulfonyl)-6-tert-butyl-N-[2-(4-pyrrolidin-1-ylsulfonylphenoxy)ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 125070862 |
| Molecular Formula | C31H37N3O7S2 |
| Molecular Weight | 627.79 g/mol |
| Exact Mass | 627.21 |
| IUPAC Name | (2R)-4-(benzenesulfonyl)-6-tert-butyl-N-[2-(4-pyrrolidin-1-ylsulfonylphenoxy)ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | CC(C)(C)c1ccc2c(c1)N(S(=O)(=O)c1ccccc1)C[C@H](C(=O)NCCOc1ccc(S(=O)(=O)N3CCCC3)cc1)O2 |
| InChI | InChI=1S/C31H37N3O7S2/c1-31(2,3)23-11-16-28-27(21-23)34(43(38,39)25-9-5-4-6-10-25)22-29(41-28)30(35)32-17-20-40-24-12-14-26(15-13-24)42(36,37)33-18-7-8-19-33/h4-6,9-16,21,29H,7-8,17-20,22H2,1-3H3,(H,32,35)/t29-/m1/s1 |
| InChIKey | CIUUTXUCWYWYBV-GDLZYMKVSA-N |
| XLogP | 3.92 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.79 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|