C29H33N3O7S2 — CID 133244774
4-(benzenesulfonyl)-6-methyl-N-[2-(4-piperidin-1-ylsulfonylphenoxy)ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 133244774) has the molecular formula C29H33N3O7S2 and a molecular weight of 599.73 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-6-methyl-N-[2-(4-piperidin-1-ylsulfonylphenoxy)ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | 4-(benzenesulfonyl)-6-methyl-N-[2-(4-piperidin-1-ylsulfonylphenoxy)ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 133244774 |
| Molecular Formula | C29H33N3O7S2 |
| Molecular Weight | 599.73 g/mol |
| Exact Mass | 599.18 |
| IUPAC Name | 4-(benzenesulfonyl)-6-methyl-N-[2-(4-piperidin-1-ylsulfonylphenoxy)ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | Cc1ccc2c(c1)N(S(=O)(=O)c1ccccc1)CC(C(=O)NCCOc1ccc(S(=O)(=O)N3CCCCC3)cc1)O2 |
| InChI | InChI=1S/C29H33N3O7S2/c1-22-10-15-27-26(20-22)32(41(36,37)24-8-4-2-5-9-24)21-28(39-27)29(33)30-16-19-38-23-11-13-25(14-12-23)40(34,35)31-17-6-3-7-18-31/h2,4-5,8-15,20,28H,3,6-7,16-19,21H2,1H3,(H,30,33) |
| InChIKey | WBSJIVBIDTYFDX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.73 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|