C26H28N2O7S — CID 125065321
(2R)-N-[2-(2-methoxyphenoxy)ethyl]-4-(4-methoxyphenyl)sulfonyl-6-methyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 125065321) has the molecular formula C26H28N2O7S and a molecular weight of 512.58 g/mol. Its IUPAC name is (2R)-N-[2-(2-methoxyphenoxy)ethyl]-4-(4-methoxyphenyl)sulfonyl-6-methyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | (2R)-N-[2-(2-methoxyphenoxy)ethyl]-4-(4-methoxyphenyl)sulfonyl-6-methyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 125065321 |
| Molecular Formula | C26H28N2O7S |
| Molecular Weight | 512.58 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | (2R)-N-[2-(2-methoxyphenoxy)ethyl]-4-(4-methoxyphenyl)sulfonyl-6-methyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2C[C@H](C(=O)NCCOc3ccccc3OC)Oc3ccc(C)cc32)cc1 |
| InChI | InChI=1S/C26H28N2O7S/c1-18-8-13-22-21(16-18)28(36(30,31)20-11-9-19(32-2)10-12-20)17-25(35-22)26(29)27-14-15-34-24-7-5-4-6-23(24)33-3/h4-13,16,25H,14-15,17H2,1-3H3,(H,27,29)/t25-/m1/s1 |
| InChIKey | PAPCOUUMPOLBNU-RUZDIDTESA-N |
| XLogP | 3.16 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.58 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|