C29H34N2O6S — CID 125064772
(2R)-N-[2-(4-tert-butylphenoxy)ethyl]-4-(4-methoxyphenyl)sulfonyl-6-methyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 125064772) has the molecular formula C29H34N2O6S and a molecular weight of 538.67 g/mol. Its IUPAC name is (2R)-N-[2-(4-tert-butylphenoxy)ethyl]-4-(4-methoxyphenyl)sulfonyl-6-methyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | (2R)-N-[2-(4-tert-butylphenoxy)ethyl]-4-(4-methoxyphenyl)sulfonyl-6-methyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 125064772 |
| Molecular Formula | C29H34N2O6S |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | (2R)-N-[2-(4-tert-butylphenoxy)ethyl]-4-(4-methoxyphenyl)sulfonyl-6-methyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2C[C@H](C(=O)NCCOc3ccc(C(C)(C)C)cc3)Oc3ccc(C)cc32)cc1 |
| InChI | InChI=1S/C29H34N2O6S/c1-20-6-15-26-25(18-20)31(38(33,34)24-13-11-22(35-5)12-14-24)19-27(37-26)28(32)30-16-17-36-23-9-7-21(8-10-23)29(2,3)4/h6-15,18,27H,16-17,19H2,1-5H3,(H,30,32)/t27-/m1/s1 |
| InChIKey | GJEMWKGTEHCIKB-HHHXNRCGSA-N |
| XLogP | 4.45 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|