C25H25ClN2O6S — CID 133234448
N-[2-(2-chlorophenoxy)ethyl]-4-(4-methoxyphenyl)sulfonyl-6-methyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 133234448) has the molecular formula C25H25ClN2O6S and a molecular weight of 517.00 g/mol. Its IUPAC name is N-[2-(2-chlorophenoxy)ethyl]-4-(4-methoxyphenyl)sulfonyl-6-methyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | N-[2-(2-chlorophenoxy)ethyl]-4-(4-methoxyphenyl)sulfonyl-6-methyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 133234448 |
| Molecular Formula | C25H25ClN2O6S |
| Molecular Weight | 517.00 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | N-[2-(2-chlorophenoxy)ethyl]-4-(4-methoxyphenyl)sulfonyl-6-methyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CC(C(=O)NCCOc3ccccc3Cl)Oc3ccc(C)cc32)cc1 |
| InChI | InChI=1S/C25H25ClN2O6S/c1-17-7-12-23-21(15-17)28(35(30,31)19-10-8-18(32-2)9-11-19)16-24(34-23)25(29)27-13-14-33-22-6-4-3-5-20(22)26/h3-12,15,24H,13-14,16H2,1-2H3,(H,27,29) |
| InChIKey | QLDATRUUOPDFKP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.00 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|