C24H23ClN2O5S — CID 125065513
(2R)-4-(benzenesulfonyl)-N-[2-(4-chlorophenoxy)ethyl]-6-methyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 125065513) has the molecular formula C24H23ClN2O5S and a molecular weight of 486.98 g/mol. Its IUPAC name is (2R)-4-(benzenesulfonyl)-N-[2-(4-chlorophenoxy)ethyl]-6-methyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | (2R)-4-(benzenesulfonyl)-N-[2-(4-chlorophenoxy)ethyl]-6-methyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 125065513 |
| Molecular Formula | C24H23ClN2O5S |
| Molecular Weight | 486.98 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | (2R)-4-(benzenesulfonyl)-N-[2-(4-chlorophenoxy)ethyl]-6-methyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | Cc1ccc2c(c1)N(S(=O)(=O)c1ccccc1)C[C@H](C(=O)NCCOc1ccc(Cl)cc1)O2 |
| InChI | InChI=1S/C24H23ClN2O5S/c1-17-7-12-22-21(15-17)27(33(29,30)20-5-3-2-4-6-20)16-23(32-22)24(28)26-13-14-31-19-10-8-18(25)9-11-19/h2-12,15,23H,13-14,16H2,1H3,(H,26,28)/t23-/m1/s1 |
| InChIKey | RZTNAENYBQMURD-HSZRJFAPSA-N |
| XLogP | 3.80 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.98 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|