C25H26ClN3O7S2 — CID 133240502
4-(benzenesulfonyl)-6-chloro-N-[2-[4-(dimethylsulfamoyl)phenoxy]ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 133240502) has the molecular formula C25H26ClN3O7S2 and a molecular weight of 580.08 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-6-chloro-N-[2-[4-(dimethylsulfamoyl)phenoxy]ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | 4-(benzenesulfonyl)-6-chloro-N-[2-[4-(dimethylsulfamoyl)phenoxy]ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 133240502 |
| Molecular Formula | C25H26ClN3O7S2 |
| Molecular Weight | 580.08 g/mol |
| Exact Mass | 579.09 |
| IUPAC Name | 4-(benzenesulfonyl)-6-chloro-N-[2-[4-(dimethylsulfamoyl)phenoxy]ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(OCCNC(=O)C2CN(S(=O)(=O)c3ccccc3)c3cc(Cl)ccc3O2)cc1 |
| InChI | InChI=1S/C25H26ClN3O7S2/c1-28(2)37(31,32)21-11-9-19(10-12-21)35-15-14-27-25(30)24-17-29(22-16-18(26)8-13-23(22)36-24)38(33,34)20-6-4-3-5-7-20/h3-13,16,24H,14-15,17H2,1-2H3,(H,27,30) |
| InChIKey | CXARUTFICJCXJI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.08 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|