C24H22Cl2N2O5S — CID 133240399
N-[2-(3-chloro-4-methylphenoxy)ethyl]-4-(4-chlorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 133240399) has the molecular formula C24H22Cl2N2O5S and a molecular weight of 521.42 g/mol. Its IUPAC name is N-[2-(3-chloro-4-methylphenoxy)ethyl]-4-(4-chlorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | N-[2-(3-chloro-4-methylphenoxy)ethyl]-4-(4-chlorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 133240399 |
| Molecular Formula | C24H22Cl2N2O5S |
| Molecular Weight | 521.42 g/mol |
| Exact Mass | 520.06 |
| IUPAC Name | N-[2-(3-chloro-4-methylphenoxy)ethyl]-4-(4-chlorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | Cc1ccc(OCCNC(=O)C2CN(S(=O)(=O)c3ccc(Cl)cc3)c3ccccc3O2)cc1Cl |
| InChI | InChI=1S/C24H22Cl2N2O5S/c1-16-6-9-18(14-20(16)26)32-13-12-27-24(29)23-15-28(21-4-2-3-5-22(21)33-23)34(30,31)19-10-7-17(25)8-11-19/h2-11,14,23H,12-13,15H2,1H3,(H,27,29) |
| InChIKey | RVFGZASXMOMOOF-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|