C26H28N2O6S — CID 133165960
N-[2-(2,3-dimethylphenoxy)ethyl]-4-(4-methoxyphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 133165960) has the molecular formula C26H28N2O6S and a molecular weight of 496.59 g/mol. Its IUPAC name is N-[2-(2,3-dimethylphenoxy)ethyl]-4-(4-methoxyphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | N-[2-(2,3-dimethylphenoxy)ethyl]-4-(4-methoxyphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 133165960 |
| Molecular Formula | C26H28N2O6S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | N-[2-(2,3-dimethylphenoxy)ethyl]-4-(4-methoxyphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CC(C(=O)NCCOc3cccc(C)c3C)Oc3ccccc32)cc1 |
| InChI | InChI=1S/C26H28N2O6S/c1-18-7-6-10-23(19(18)2)33-16-15-27-26(29)25-17-28(22-8-4-5-9-24(22)34-25)35(30,31)21-13-11-20(32-3)12-14-21/h4-14,25H,15-17H2,1-3H3,(H,27,29) |
| InChIKey | PDRZXYUPPNEDJZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|