C23H20ClFN2O5S — CID 133236011
4-(benzenesulfonyl)-6-chloro-N-[2-(4-fluorophenoxy)ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 133236011) has the molecular formula C23H20ClFN2O5S and a molecular weight of 490.94 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-6-chloro-N-[2-(4-fluorophenoxy)ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | 4-(benzenesulfonyl)-6-chloro-N-[2-(4-fluorophenoxy)ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 133236011 |
| Molecular Formula | C23H20ClFN2O5S |
| Molecular Weight | 490.94 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | 4-(benzenesulfonyl)-6-chloro-N-[2-(4-fluorophenoxy)ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | O=C(NCCOc1ccc(F)cc1)C1CN(S(=O)(=O)c2ccccc2)c2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C23H20ClFN2O5S/c24-16-6-11-21-20(14-16)27(33(29,30)19-4-2-1-3-5-19)15-22(32-21)23(28)26-12-13-31-18-9-7-17(25)8-10-18/h1-11,14,22H,12-13,15H2,(H,26,28) |
| InChIKey | WLMAOIKFZDPEJR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.94 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|