C25H27N3O7S2 — CID 133240432
4-(benzenesulfonyl)-N-[2-[4-(dimethylsulfamoyl)phenoxy]ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 133240432) has the molecular formula C25H27N3O7S2 and a molecular weight of 545.64 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-N-[2-[4-(dimethylsulfamoyl)phenoxy]ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | 4-(benzenesulfonyl)-N-[2-[4-(dimethylsulfamoyl)phenoxy]ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 133240432 |
| Molecular Formula | C25H27N3O7S2 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.13 |
| IUPAC Name | 4-(benzenesulfonyl)-N-[2-[4-(dimethylsulfamoyl)phenoxy]ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(OCCNC(=O)C2CN(S(=O)(=O)c3ccccc3)c3ccccc3O2)cc1 |
| InChI | InChI=1S/C25H27N3O7S2/c1-27(2)36(30,31)21-14-12-19(13-15-21)34-17-16-26-25(29)24-18-28(22-10-6-7-11-23(22)35-24)37(32,33)20-8-4-3-5-9-20/h3-15,24H,16-18H2,1-2H3,(H,26,29) |
| InChIKey | NRZFEUFRBPTPAJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|