C28H31ClN2O6S — CID 125064740
(2R)-6-tert-butyl-N-[2-(4-chlorophenoxy)ethyl]-4-(4-methoxyphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 125064740) has the molecular formula C28H31ClN2O6S and a molecular weight of 559.08 g/mol. Its IUPAC name is (2R)-6-tert-butyl-N-[2-(4-chlorophenoxy)ethyl]-4-(4-methoxyphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | (2R)-6-tert-butyl-N-[2-(4-chlorophenoxy)ethyl]-4-(4-methoxyphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 125064740 |
| Molecular Formula | C28H31ClN2O6S |
| Molecular Weight | 559.08 g/mol |
| Exact Mass | 558.16 |
| IUPAC Name | (2R)-6-tert-butyl-N-[2-(4-chlorophenoxy)ethyl]-4-(4-methoxyphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2C[C@H](C(=O)NCCOc3ccc(Cl)cc3)Oc3ccc(C(C)(C)C)cc32)cc1 |
| InChI | InChI=1S/C28H31ClN2O6S/c1-28(2,3)19-5-14-25-24(17-19)31(38(33,34)23-12-10-21(35-4)11-13-23)18-26(37-25)27(32)30-15-16-36-22-8-6-20(29)7-9-22/h5-14,17,26H,15-16,18H2,1-4H3,(H,30,32)/t26-/m1/s1 |
| InChIKey | FEFYXCSTYFNSNM-AREMUKBSSA-N |
| XLogP | 4.80 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.08 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|