C26H35N3O8S2 — CID 125072015
(2R)-6-tert-butyl-4-methylsulfonyl-N-[2-(4-morpholin-4-ylsulfonylphenoxy)ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 125072015) has the molecular formula C26H35N3O8S2 and a molecular weight of 581.71 g/mol. Its IUPAC name is (2R)-6-tert-butyl-4-methylsulfonyl-N-[2-(4-morpholin-4-ylsulfonylphenoxy)ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | (2R)-6-tert-butyl-4-methylsulfonyl-N-[2-(4-morpholin-4-ylsulfonylphenoxy)ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 125072015 |
| Molecular Formula | C26H35N3O8S2 |
| Molecular Weight | 581.71 g/mol |
| Exact Mass | 581.19 |
| IUPAC Name | (2R)-6-tert-butyl-4-methylsulfonyl-N-[2-(4-morpholin-4-ylsulfonylphenoxy)ethyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | CC(C)(C)c1ccc2c(c1)N(S(C)(=O)=O)C[C@H](C(=O)NCCOc1ccc(S(=O)(=O)N3CCOCC3)cc1)O2 |
| InChI | InChI=1S/C26H35N3O8S2/c1-26(2,3)19-5-10-23-22(17-19)29(38(4,31)32)18-24(37-23)25(30)27-11-14-36-20-6-8-21(9-7-20)39(33,34)28-12-15-35-16-13-28/h5-10,17,24H,11-16,18H2,1-4H3,(H,27,30)/t24-/m1/s1 |
| InChIKey | WEMDSWFZRYBOKR-XMMPIXPASA-N |
| XLogP | 1.73 |
| TPSA | 131.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.71 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|