C33H33Cl2N3O4 — CID 133261198
N-[1-(cyclopentylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2,6-dichlorophenyl)methyl]-4-(1,3-dioxoisoindol-2-yl)butanamide (PubChem CID 133261198) has the molecular formula C33H33Cl2N3O4 and a molecular weight of 606.55 g/mol. Its IUPAC name is N-[1-(cyclopentylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2,6-dichlorophenyl)methyl]-4-(1,3-dioxoisoindol-2-yl)butanamide.
| Compound Name | N-[1-(cyclopentylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2,6-dichlorophenyl)methyl]-4-(1,3-dioxoisoindol-2-yl)butanamide |
|---|---|
| PubChem CID | 133261198 |
| Molecular Formula | C33H33Cl2N3O4 |
| Molecular Weight | 606.55 g/mol |
| Exact Mass | 605.18 |
| IUPAC Name | N-[1-(cyclopentylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2,6-dichlorophenyl)methyl]-4-(1,3-dioxoisoindol-2-yl)butanamide |
| SMILES | O=C(NC1CCCC1)C(Cc1ccccc1)N(Cc1c(Cl)cccc1Cl)C(=O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C33H33Cl2N3O4/c34-27-16-8-17-28(35)26(27)21-38(29(20-22-10-2-1-3-11-22)31(40)36-23-12-4-5-13-23)30(39)18-9-19-37-32(41)24-14-6-7-15-25(24)33(37)42/h1-3,6-8,10-11,14-17,23,29H,4-5,9,12-13,18-21H2,(H,36,40) |
| InChIKey | SPGLNDKCGRNAFP-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.55 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|