C15H20F2N2O3 — CID 133267024
4-(difluoromethoxy)-N-[(3R,4R)-1-ethyl-4-methoxypyrrolidin-3-yl]benzamide (PubChem CID 133267024) has the molecular formula C15H20F2N2O3 and a molecular weight of 314.33 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-[(3R,4R)-1-ethyl-4-methoxypyrrolidin-3-yl]benzamide.
| Compound Name | 4-(difluoromethoxy)-N-[(3R,4R)-1-ethyl-4-methoxypyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 133267024 |
| Molecular Formula | C15H20F2N2O3 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 4-(difluoromethoxy)-N-[(3R,4R)-1-ethyl-4-methoxypyrrolidin-3-yl]benzamide |
| SMILES | CCN1C[C@@H](NC(=O)c2ccc(OC(F)F)cc2)[C@H](OC)C1 |
| InChI | InChI=1S/C15H20F2N2O3/c1-3-19-8-12(13(9-19)21-2)18-14(20)10-4-6-11(7-5-10)22-15(16)17/h4-7,12-13,15H,3,8-9H2,1-2H3,(H,18,20)/t12-,13-/m1/s1 |
| InChIKey | FRYVSACDSZAPIW-CHWSQXEVSA-N |
| XLogP | 1.74 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |