C15H19N3O2 — CID 133268317
3-cyano-N-[(3R,4R)-1-ethyl-4-methoxypyrrolidin-3-yl]benzamide (PubChem CID 133268317) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 3-cyano-N-[(3R,4R)-1-ethyl-4-methoxypyrrolidin-3-yl]benzamide.
| Compound Name | 3-cyano-N-[(3R,4R)-1-ethyl-4-methoxypyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 133268317 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 3-cyano-N-[(3R,4R)-1-ethyl-4-methoxypyrrolidin-3-yl]benzamide |
| SMILES | CCN1C[C@@H](NC(=O)c2cccc(C#N)c2)[C@H](OC)C1 |
| InChI | InChI=1S/C15H19N3O2/c1-3-18-9-13(14(10-18)20-2)17-15(19)12-6-4-5-11(7-12)8-16/h4-7,13-14H,3,9-10H2,1-2H3,(H,17,19)/t13-,14-/m1/s1 |
| InChIKey | GSZRLHIPDGUFEZ-ZIAGYGMSSA-N |
| XLogP | 1.01 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |