C14H22N2O4 — CID 133267426
N-[(3S,4R)-4-[2-(dimethylamino)ethoxy]oxan-3-yl]furan-2-carboxamide (PubChem CID 133267426) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is N-[(3S,4R)-4-[2-(dimethylamino)ethoxy]oxan-3-yl]furan-2-carboxamide.
| Compound Name | N-[(3S,4R)-4-[2-(dimethylamino)ethoxy]oxan-3-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 133267426 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | N-[(3S,4R)-4-[2-(dimethylamino)ethoxy]oxan-3-yl]furan-2-carboxamide |
| SMILES | CN(C)CCO[C@@H]1CCOC[C@@H]1NC(=O)c1ccco1 |
| InChI | InChI=1S/C14H22N2O4/c1-16(2)6-9-20-12-5-8-18-10-11(12)15-14(17)13-4-3-7-19-13/h3-4,7,11-12H,5-6,8-10H2,1-2H3,(H,15,17)/t11-,12+/m0/s1 |
| InChIKey | ODAKRTWWADTSAD-NWDGAFQWSA-N |
| XLogP | 0.75 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |