C18H19N3O4S — CID 133268312
3-cyano-N-[(3S,4S)-3-[(6-methyl-3-pyridinyl)oxy]oxan-4-yl]benzenesulfonamide (PubChem CID 133268312) has the molecular formula C18H19N3O4S and a molecular weight of 373.43 g/mol. Its IUPAC name is 3-cyano-N-[(3S,4S)-3-[(6-methyl-3-pyridinyl)oxy]oxan-4-yl]benzenesulfonamide.
| Compound Name | 3-cyano-N-[(3S,4S)-3-[(6-methyl-3-pyridinyl)oxy]oxan-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 133268312 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 3-cyano-N-[(3S,4S)-3-[(6-methyl-3-pyridinyl)oxy]oxan-4-yl]benzenesulfonamide |
| SMILES | Cc1ccc(O[C@@H]2COCC[C@@H]2NS(=O)(=O)c2cccc(C#N)c2)cn1 |
| InChI | InChI=1S/C18H19N3O4S/c1-13-5-6-15(11-20-13)25-18-12-24-8-7-17(18)21-26(22,23)16-4-2-3-14(9-16)10-19/h2-6,9,11,17-18,21H,7-8,12H2,1H3/t17-,18+/m0/s1 |
| InChIKey | HPIBMLKBOBNSCC-ZWKOTPCHSA-N |
| XLogP | 1.78 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |