C17H20N4O4S — CID 91773650
N-[(3S,4R)-3-(4-cyanophenoxy)oxan-4-yl]-2,5-dimethylpyrazole-3-sulfonamide (PubChem CID 91773650) has the molecular formula C17H20N4O4S and a molecular weight of 376.44 g/mol. Its IUPAC name is N-[(3S,4R)-3-(4-cyanophenoxy)oxan-4-yl]-2,5-dimethylpyrazole-3-sulfonamide.
| Compound Name | N-[(3S,4R)-3-(4-cyanophenoxy)oxan-4-yl]-2,5-dimethylpyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 91773650 |
| Molecular Formula | C17H20N4O4S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | N-[(3S,4R)-3-(4-cyanophenoxy)oxan-4-yl]-2,5-dimethylpyrazole-3-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N[C@@H]2CCOC[C@H]2Oc2ccc(C#N)cc2)n(C)n1 |
| InChI | InChI=1S/C17H20N4O4S/c1-12-9-17(21(2)19-12)26(22,23)20-15-7-8-24-11-16(15)25-14-5-3-13(10-18)4-6-14/h3-6,9,15-16,20H,7-8,11H2,1-2H3/t15-,16-/m1/s1 |
| InChIKey | XCYFNXQLYNZLHR-HZPDHXFCSA-N |
| XLogP | 1.12 |
| TPSA | 106.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |