C20H22ClFN2O2 — CID 133276893
1-[2-[[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]amino]-6-fluorophenyl]ethanone (PubChem CID 133276893) has the molecular formula C20H22ClFN2O2 and a molecular weight of 376.86 g/mol. Its IUPAC name is 1-[2-[[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]amino]-6-fluorophenyl]ethanone.
| Compound Name | 1-[2-[[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]amino]-6-fluorophenyl]ethanone |
|---|---|
| PubChem CID | 133276893 |
| Molecular Formula | C20H22ClFN2O2 |
| Molecular Weight | 376.86 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 1-[2-[[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]amino]-6-fluorophenyl]ethanone |
| SMILES | CC(=O)c1c(F)cccc1NCC(c1ccc(Cl)cc1)N1CCOCC1 |
| InChI | InChI=1S/C20H22ClFN2O2/c1-14(25)20-17(22)3-2-4-18(20)23-13-19(24-9-11-26-12-10-24)15-5-7-16(21)8-6-15/h2-8,19,23H,9-13H2,1H3 |
| InChIKey | FMDRCICHSXITRZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.86 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |