C22H22ClN5O2 — CID 133278022
2-benzyl-4-chloro-5-[[1-(pyridine-4-carbonyl)piperidin-4-yl]amino]pyridazin-3-one (PubChem CID 133278022) has the molecular formula C22H22ClN5O2 and a molecular weight of 423.90 g/mol. Its IUPAC name is 2-benzyl-4-chloro-5-[[1-(pyridine-4-carbonyl)piperidin-4-yl]amino]pyridazin-3-one.
| Compound Name | 2-benzyl-4-chloro-5-[[1-(pyridine-4-carbonyl)piperidin-4-yl]amino]pyridazin-3-one |
|---|---|
| PubChem CID | 133278022 |
| Molecular Formula | C22H22ClN5O2 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 2-benzyl-4-chloro-5-[[1-(pyridine-4-carbonyl)piperidin-4-yl]amino]pyridazin-3-one |
| SMILES | O=C(c1ccncc1)N1CCC(Nc2cnn(Cc3ccccc3)c(=O)c2Cl)CC1 |
| InChI | InChI=1S/C22H22ClN5O2/c23-20-19(14-25-28(22(20)30)15-16-4-2-1-3-5-16)26-18-8-12-27(13-9-18)21(29)17-6-10-24-11-7-17/h1-7,10-11,14,18,26H,8-9,12-13,15H2 |
| InChIKey | WQCOCMYYAPSGTO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |