C17H20ClN3O — CID 133417909
2-benzyl-4-chloro-5-(1-cyclobutylethylamino)pyridazin-3-one (PubChem CID 133417909) has the molecular formula C17H20ClN3O and a molecular weight of 317.82 g/mol. Its IUPAC name is 2-benzyl-4-chloro-5-(1-cyclobutylethylamino)pyridazin-3-one.
| Compound Name | 2-benzyl-4-chloro-5-(1-cyclobutylethylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 133417909 |
| Molecular Formula | C17H20ClN3O |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 2-benzyl-4-chloro-5-(1-cyclobutylethylamino)pyridazin-3-one |
| SMILES | CC(Nc1cnn(Cc2ccccc2)c(=O)c1Cl)C1CCC1 |
| InChI | InChI=1S/C17H20ClN3O/c1-12(14-8-5-9-14)20-15-10-19-21(17(22)16(15)18)11-13-6-3-2-4-7-13/h2-4,6-7,10,12,14,20H,5,8-9,11H2,1H3 |
| InChIKey | MAJOVAKAXGZAMV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |