C16H18N6O — CID 133279385
6-[4-(3-methoxyphenyl)piperidin-1-yl]tetrazolo[1,5-b]pyridazine (PubChem CID 133279385) has the molecular formula C16H18N6O and a molecular weight of 310.36 g/mol. Its IUPAC name is 6-[4-(3-methoxyphenyl)piperidin-1-yl]tetrazolo[1,5-b]pyridazine.
| Compound Name | 6-[4-(3-methoxyphenyl)piperidin-1-yl]tetrazolo[1,5-b]pyridazine |
|---|---|
| PubChem CID | 133279385 |
| Molecular Formula | C16H18N6O |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 6-[4-(3-methoxyphenyl)piperidin-1-yl]tetrazolo[1,5-b]pyridazine |
| SMILES | COc1cccc(C2CCN(c3ccc4nnnn4n3)CC2)c1 |
| InChI | InChI=1S/C16H18N6O/c1-23-14-4-2-3-13(11-14)12-7-9-21(10-8-12)16-6-5-15-17-19-20-22(15)18-16/h2-6,11-12H,7-10H2,1H3 |
| InChIKey | FSHJLNSOJMUWIU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 68.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |