About 3-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)-N-benzylpropanamide
3-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)-N-benzylpropanamide (PubChem CID 133279534) has the molecular formula C20H18N4O2
and a molecular weight of 346.39 g/mol. Its IUPAC name is 3-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)-N-benzylpropanamide.
Molecular Properties
| Compound Name | 3-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)-N-benzylpropanamide |
| PubChem CID | 133279534 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 3-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)-N-benzylpropanamide |
| SMILES | O=C(CCNc1ncnc2c1oc1ccccc12)NCc1ccccc1 |
| InChI | InChI=1S/C20H18N4O2/c25-17(22-12-14-6-2-1-3-7-14)10-11-21-20-19-18(23-13-24-20)15-8-4-5-9-16(15)26-19/h1-9,13H,10-12H2,(H,22,25)(H,21,23,24) |
| InChIKey | HGJXKIZKRLBWIN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)-N-benzylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)-N-benzylpropanamide?
The IUPAC name of 3-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)-N-benzylpropanamide (CID 133279534) is 3-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)-N-benzylpropanamide.
What is the SMILES notation for 3-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)-N-benzylpropanamide?
The canonical SMILES for 3-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)-N-benzylpropanamide is O=C(CCNc1ncnc2c1oc1ccccc12)NCc1ccccc1.
What is the InChIKey of 3-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)-N-benzylpropanamide?
The InChIKey is HGJXKIZKRLBWIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N4O2/c25-17(22-12-14-6-2-1-3-7-14)10-11-21-20-19-18(23-13-24-20)15-8-4-5-9-16(15)26-19/h1-9,13H,10-12H2,(H,22,25)(H,21,23,24).
What are the key properties of 3-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)-N-benzylpropanamide?
3-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)-N-benzylpropanamide has a molecular weight of 346.39 g/mol, XLogP of 3.49, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)-N-benzylpropanamide is sourced from PubChem (CID 133279534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).