C15H14N4O — CID 133299937
5-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)pentanenitrile (PubChem CID 133299937) has the molecular formula C15H14N4O and a molecular weight of 266.30 g/mol. Its IUPAC name is 5-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)pentanenitrile.
| Compound Name | 5-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)pentanenitrile |
|---|---|
| PubChem CID | 133299937 |
| Molecular Formula | C15H14N4O |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 5-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)pentanenitrile |
| SMILES | N#CCCCCNc1ncnc2c1oc1ccccc12 |
| InChI | InChI=1S/C15H14N4O/c16-8-4-1-5-9-17-15-14-13(18-10-19-15)11-6-2-3-7-12(11)20-14/h2-3,6-7,10H,1,4-5,9H2,(H,17,18,19) |
| InChIKey | ZZFVUNIDBLQXGJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|