C18H23N3O — CID 2311028
N-[(2R)-2-ethylhexyl]-[1]benzofuro[3,2-d]pyrimidin-4-amine (PubChem CID 2311028) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is N-[(2R)-2-ethylhexyl]-[1]benzofuro[3,2-d]pyrimidin-4-amine.
| Compound Name | N-[(2R)-2-ethylhexyl]-[1]benzofuro[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 2311028 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | N-[(2R)-2-ethylhexyl]-[1]benzofuro[3,2-d]pyrimidin-4-amine |
| SMILES | CCCC[C@@H](CC)CNc1ncnc2c1oc1ccccc12 |
| InChI | InChI=1S/C18H23N3O/c1-3-5-8-13(4-2)11-19-18-17-16(20-12-21-18)14-9-6-7-10-15(14)22-17/h6-7,9-10,12-13H,3-5,8,11H2,1-2H3,(H,19,20,21)/t13-/m1/s1 |
| InChIKey | GYGTUGBIBDDZDX-CYBMUJFWSA-N |
| XLogP | 5.00 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |