C16H19N7O3 — CID 133281136
2-[methyl-(1-pyridazin-3-ylpiperidin-3-yl)amino]-5-nitropyridine-3-carboxamide (PubChem CID 133281136) has the molecular formula C16H19N7O3 and a molecular weight of 357.37 g/mol. Its IUPAC name is 2-[methyl-(1-pyridazin-3-ylpiperidin-3-yl)amino]-5-nitropyridine-3-carboxamide.
| Compound Name | 2-[methyl-(1-pyridazin-3-ylpiperidin-3-yl)amino]-5-nitropyridine-3-carboxamide |
|---|---|
| PubChem CID | 133281136 |
| Molecular Formula | C16H19N7O3 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 2-[methyl-(1-pyridazin-3-ylpiperidin-3-yl)amino]-5-nitropyridine-3-carboxamide |
| SMILES | CN(c1ncc([N+](=O)[O-])cc1C(N)=O)C1CCCN(c2cccnn2)C1 |
| InChI | InChI=1S/C16H19N7O3/c1-21(16-13(15(17)24)8-12(9-18-16)23(25)26)11-4-3-7-22(10-11)14-5-2-6-19-20-14/h2,5-6,8-9,11H,3-4,7,10H2,1H3,(H2,17,24) |
| InChIKey | UZTUTBWPTLQQOY-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 131.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|